C28H52N2Sn — CID 59891582
(10R,17S)-17-[1-(dimethylamino)ethyl]-N,N,10-trimethyl-15-((119Sn)trimethyl(119Sn)stannylmethyl)-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-amine (PubChem CID 59891582) has the molecular formula C28H52N2Sn and a molecular weight of 535.64 g/mol. Its IUPAC name is (10R,17S)-17-[1-(dimethylamino)ethyl]-N,N,10-trimethyl-15-((119Sn)trimethyl(119Sn)stannylmethyl)-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-amine.
| Compound Name | (10R,17S)-17-[1-(dimethylamino)ethyl]-N,N,10-trimethyl-15-((119Sn)trimethyl(119Sn)stannylmethyl)-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 59891582 |
| Molecular Formula | C28H52N2Sn |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | (10R,17S)-17-[1-(dimethylamino)ethyl]-N,N,10-trimethyl-15-((119Sn)trimethyl(119Sn)stannylmethyl)-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-amine |
| SMILES | CC([C@H]1CC(C[119Sn](C)(C)C)C2C3CC=C4CC(N(C)C)CC[C@]4(C)C3CCC21)N(C)C |
| InChI | InChI=1S/C25H43N2.3CH3.Sn/c1-16-14-22(17(2)26(4)5)20-10-11-23-21(24(16)20)9-8-18-15-19(27(6)7)12-13-25(18,23)3;;;;/h8,16-17,19-24H,1,9-15H2,2-7H3;3*1H3;/t16?,17?,19?,20?,21?,22-,23?,24?,25+;;;;/m1..../s1/i;;;;1+0 |
| InChIKey | CCQODBXVSVFDOF-SMCFWDIMSA-N |
| XLogP | 6.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|