C19H13FN2O4S3 — CID 59893154
[2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonate (PubChem CID 59893154) has the molecular formula C19H13FN2O4S3 and a molecular weight of 448.52 g/mol. Its IUPAC name is [2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonate.
| Compound Name | [2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 59893154 |
| Molecular Formula | C19H13FN2O4S3 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | [2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonate |
| SMILES | CN1C(=C(F)c2oc3ccc4ccccc4c3[n+]2CS(=O)(=O)[O-])Sc2sccc21 |
| InChI | InChI=1S/C19H13FN2O4S3/c1-21-13-8-9-27-19(13)28-18(21)15(20)17-22(10-29(23,24)25)16-12-5-3-2-4-11(12)6-7-14(16)26-17/h2-9H,10H2,1H3 |
| InChIKey | CGTVQHSPZFSSJC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 77.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|