C19H14FN2O4S3+ — CID 59893155
[2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonic acid (PubChem CID 59893155) has the molecular formula C19H14FN2O4S3+ and a molecular weight of 449.53 g/mol. Its IUPAC name is [2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonic acid.
| Compound Name | [2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 59893155 |
| Molecular Formula | C19H14FN2O4S3+ |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | [2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonic acid |
| SMILES | CN1C(=C(F)c2oc3ccc4ccccc4c3[n+]2CS(=O)(=O)O)Sc2sccc21 |
| InChI | InChI=1S/C19H13FN2O4S3/c1-21-13-8-9-27-19(13)28-18(21)15(20)17-22(10-29(23,24)25)16-12-5-3-2-4-11(12)6-7-14(16)26-17/h2-9H,10H2,1H3/p+1 |
| InChIKey | CGTVQHSPZFSSJC-UHFFFAOYSA-O |
| XLogP | 4.62 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|