C21H18FN2O4S3+ — CID 91008049
3-[2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 91008049) has the molecular formula C21H18FN2O4S3+ and a molecular weight of 477.58 g/mol. Its IUPAC name is 3-[2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91008049 |
| Molecular Formula | C21H18FN2O4S3+ |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 3-[2-[fluoro-(1-methylthieno[3,2-d][1,3]thiazol-2-ylidene)methyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CN1C(=C(F)c2oc3ccc4ccccc4c3[n+]2CCCS(=O)(=O)O)Sc2sccc21 |
| InChI | InChI=1S/C21H17FN2O4S3/c1-23-15-9-11-29-21(15)30-20(23)17(22)19-24(10-4-12-31(25,26)27)18-14-6-3-2-5-13(14)7-8-16(18)28-19/h2-3,5-9,11H,4,10,12H2,1H3/p+1 |
| InChIKey | LIEFSDHRLLQPJO-UHFFFAOYSA-O |
| XLogP | 5.05 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|