C17H13Br2N2O6S4+ — CID 59893214
[(2Z)-5-bromo-2-[[5-bromo-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]methanesulfonic acid (PubChem CID 59893214) has the molecular formula C17H13Br2N2O6S4+ and a molecular weight of 629.38 g/mol. Its IUPAC name is [(2Z)-5-bromo-2-[[5-bromo-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]methanesulfonic acid.
| Compound Name | [(2Z)-5-bromo-2-[[5-bromo-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 59893214 |
| Molecular Formula | C17H13Br2N2O6S4+ |
| Molecular Weight | 629.38 g/mol |
| Exact Mass | 626.80 |
| IUPAC Name | [(2Z)-5-bromo-2-[[5-bromo-3-(sulfomethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]methanesulfonic acid |
| SMILES | O=S(=O)(O)CN1/C(=C/c2sc3ccc(Br)cc3[n+]2CS(=O)(=O)O)Sc2ccc(Br)cc21 |
| InChI | InChI=1S/C17H12Br2N2O6S4/c18-10-1-3-14-12(5-10)20(8-30(22,23)24)16(28-14)7-17-21(9-31(25,26)27)13-6-11(19)2-4-15(13)29-17/h1-7H,8-9H2,(H-,22,23,24,25,26,27)/p+1 |
| InChIKey | WDECKUUKCSLHAU-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|