C19H14FN2O6S5+ — CID 90705379
[5-fluoro-2-[[3-(sulfomethyl)-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]methanesulfonic acid (PubChem CID 90705379) has the molecular formula C19H14FN2O6S5+ and a molecular weight of 545.66 g/mol. Its IUPAC name is [5-fluoro-2-[[3-(sulfomethyl)-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]methanesulfonic acid.
| Compound Name | [5-fluoro-2-[[3-(sulfomethyl)-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 90705379 |
| Molecular Formula | C19H14FN2O6S5+ |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 544.94 |
| IUPAC Name | [5-fluoro-2-[[3-(sulfomethyl)-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]methanesulfonic acid |
| SMILES | O=S(=O)(O)CN1C(=Cc2sc3c4ccccc4sc3[n+]2CS(=O)(=O)O)Sc2ccc(F)cc21 |
| InChI | InChI=1S/C19H13FN2O6S5/c20-11-5-6-15-13(7-11)21(9-32(23,24)25)16(29-15)8-17-22(10-33(26,27)28)19-18(31-17)12-3-1-2-4-14(12)30-19/h1-8H,9-10H2,(H-,23,24,25,26,27,28)/p+1 |
| InChIKey | IOGHFLZCZQCVHW-UHFFFAOYSA-O |
| XLogP | 4.14 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|