C23H21FN2O6S5+2 — CID 58783060
5-fluoro-2-[[3-(3-sulfopropyl)-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonic acid (PubChem CID 58783060) has the molecular formula C23H21FN2O6S5+2 and a molecular weight of 600.76 g/mol. Its IUPAC name is 5-fluoro-2-[[3-(3-sulfopropyl)-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonic acid.
| Compound Name | 5-fluoro-2-[[3-(3-sulfopropyl)-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonic acid |
|---|---|
| PubChem CID | 58783060 |
| Molecular Formula | C23H21FN2O6S5+2 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.00 |
| IUPAC Name | 5-fluoro-2-[[3-(3-sulfopropyl)-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonic acid |
| SMILES | O=S(=O)(O)CCC[n+]1c(C=C2Sc3ccc(F)cc3[N+]23CCC3S(=O)(=O)O)sc2c3ccccc3sc21 |
| InChI | InChI=1S/C23H19FN2O6S5/c24-14-6-7-18-16(12-14)26(10-8-21(26)37(30,31)32)20(33-18)13-19-25(9-3-11-36(27,28)29)23-22(35-19)15-4-1-2-5-17(15)34-23/h1-2,4-7,12-13,21H,3,8-11H2/p+2 |
| InChIKey | VNQNGXFNCTXPKW-UHFFFAOYSA-P |
| XLogP | 4.85 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|