C25H23ClN2O6S4+2 — CID 23637589
2'-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]spiro[azetidin-1-ium-1,1'-benzo[e][1,3]benzothiazol-1-ium]-2-sulfonic acid (PubChem CID 23637589) has the molecular formula C25H23ClN2O6S4+2 and a molecular weight of 611.19 g/mol. Its IUPAC name is 2'-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]spiro[azetidin-1-ium-1,1'-benzo[e][1,3]benzothiazol-1-ium]-2-sulfonic acid.
| Compound Name | 2'-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]spiro[azetidin-1-ium-1,1'-benzo[e][1,3]benzothiazol-1-ium]-2-sulfonic acid |
|---|---|
| PubChem CID | 23637589 |
| Molecular Formula | C25H23ClN2O6S4+2 |
| Molecular Weight | 611.19 g/mol |
| Exact Mass | 610.01 |
| IUPAC Name | 2'-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]spiro[azetidin-1-ium-1,1'-benzo[e][1,3]benzothiazol-1-ium]-2-sulfonic acid |
| SMILES | O=S(=O)(O)CCC[n+]1c(C=C2Sc3ccc4ccccc4c3[N+]23CCC3S(=O)(=O)O)sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H21ClN2O6S4/c26-17-7-9-20-19(14-17)27(11-3-13-37(29,30)31)22(35-20)15-23-28(12-10-24(28)38(32,33)34)25-18-5-2-1-4-16(18)6-8-21(25)36-23/h1-2,4-9,14-15,24H,3,10-13H2/p+2 |
| InChIKey | FMJLSEHCGDGHRI-UHFFFAOYSA-P |
| XLogP | 5.30 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.19 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|