C26H23ClN2O7S3+2 — CID 20825183
2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzoxazol-3-ium-3,1'-aziridin-1-ium]-2'-sulfonic acid (PubChem CID 20825183) has the molecular formula C26H23ClN2O7S3+2 and a molecular weight of 607.13 g/mol. Its IUPAC name is 2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzoxazol-3-ium-3,1'-aziridin-1-ium]-2'-sulfonic acid.
| Compound Name | 2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzoxazol-3-ium-3,1'-aziridin-1-ium]-2'-sulfonic acid |
|---|---|
| PubChem CID | 20825183 |
| Molecular Formula | C26H23ClN2O7S3+2 |
| Molecular Weight | 607.13 g/mol |
| Exact Mass | 606.03 |
| IUPAC Name | 2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzoxazol-3-ium-3,1'-aziridin-1-ium]-2'-sulfonic acid |
| SMILES | O=S(=O)(O)CCC[n+]1c(C=C2Oc3ccc(-c4ccccc4)cc3[N+]23CC3S(=O)(=O)O)sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H21ClN2O7S3/c27-19-8-10-23-20(14-19)28(11-4-12-38(30,31)32)24(37-23)15-25-29(16-26(29)39(33,34)35)21-13-18(7-9-22(21)36-25)17-5-2-1-3-6-17/h1-3,5-10,13-15,26H,4,11-12,16H2/p+2 |
| InChIKey | IXFXWYLRQJMSMR-UHFFFAOYSA-P |
| XLogP | 4.71 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.13 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|