C23H16ClN2O6S3+ — CID 59063373
2-[[1-(carboxymethyl)-5-chlorothieno[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzoxazol-3-ium-3,1'-aziridin-1-ium]-2'-sulfonate (PubChem CID 59063373) has the molecular formula C23H16ClN2O6S3+ and a molecular weight of 548.04 g/mol. Its IUPAC name is 2-[[1-(carboxymethyl)-5-chlorothieno[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzoxazol-3-ium-3,1'-aziridin-1-ium]-2'-sulfonate.
| Compound Name | 2-[[1-(carboxymethyl)-5-chlorothieno[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzoxazol-3-ium-3,1'-aziridin-1-ium]-2'-sulfonate |
|---|---|
| PubChem CID | 59063373 |
| Molecular Formula | C23H16ClN2O6S3+ |
| Molecular Weight | 548.04 g/mol |
| Exact Mass | 546.99 |
| IUPAC Name | 2-[[1-(carboxymethyl)-5-chlorothieno[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzoxazol-3-ium-3,1'-aziridin-1-ium]-2'-sulfonate |
| SMILES | O=C(O)C[n+]1c(C=C2Oc3ccc(-c4ccccc4)cc3[N+]23CC3S(=O)(=O)[O-])sc2sc(Cl)cc21 |
| InChI | InChI=1S/C23H15ClN2O6S3/c24-18-9-15-23(33-18)34-19(25(15)11-22(27)28)10-20-26(12-21(26)35(29,30)31)16-8-14(6-7-17(16)32-20)13-4-2-1-3-5-13/h1-10,21H,11-12H2/p+1 |
| InChIKey | PXQOURVGLSPXJY-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.04 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|