C28H28N2O7S4+2 — CID 23637394
2-[[5-methoxy-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzothiazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonic acid (PubChem CID 23637394) has the molecular formula C28H28N2O7S4+2 and a molecular weight of 632.81 g/mol. Its IUPAC name is 2-[[5-methoxy-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzothiazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonic acid.
| Compound Name | 2-[[5-methoxy-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzothiazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonic acid |
|---|---|
| PubChem CID | 23637394 |
| Molecular Formula | C28H28N2O7S4+2 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | 2-[[5-methoxy-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-5-phenylspiro[1,3-benzothiazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonic acid |
| SMILES | COc1ccc2sc(C=C3Sc4ccc(-c5ccccc5)cc4[N+]34CCC4S(=O)(=O)O)[n+](CCCS(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C28H26N2O7S4/c1-37-21-9-11-24-22(17-21)29(13-5-15-40(31,32)33)26(38-24)18-27-30(14-12-28(30)41(34,35)36)23-16-20(8-10-25(23)39-27)19-6-3-2-4-7-19/h2-4,6-11,16-18,28H,5,12-15H2,1H3/p+2 |
| InChIKey | HPMPRQQZLRYOHD-UHFFFAOYSA-P |
| XLogP | 5.17 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|