C25H26N2Si+2 — CID 59895351
trimethyl-[(3E)-3-(1-phenylethylidene)-1,3-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaen-14-yl]silane (PubChem CID 59895351) has the molecular formula C25H26N2Si+2 and a molecular weight of 382.58 g/mol. Its IUPAC name is trimethyl-[(3E)-3-(1-phenylethylidene)-1,3-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaen-14-yl]silane.
| Compound Name | trimethyl-[(3E)-3-(1-phenylethylidene)-1,3-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaen-14-yl]silane |
|---|---|
| PubChem CID | 59895351 |
| Molecular Formula | C25H26N2Si+2 |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | trimethyl-[(3E)-3-(1-phenylethylidene)-1,3-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaen-14-yl]silane |
| SMILES | C/C(c1ccccc1)=[N+]1\C[n+]2c([Si](C)(C)C)ccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C25H26N2Si/c1-18(19-9-6-5-7-10-19)26-17-27-23(28(2,3)4)16-15-21-14-13-20-11-8-12-22(26)24(20)25(21)27/h5-16H,17H2,1-4H3/q+2/b26-18- |
| InChIKey | VPHVQCUPNYXWAJ-ITYLOYPMSA-N |
| XLogP | 4.95 |
| TPSA | 6.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|