About 4-ethyloctane;yttrium
4-ethyloctane;yttrium (PubChem CID 59895669) has the molecular formula C10H21Y-
and a molecular weight of 230.18 g/mol. Its IUPAC name is 4-ethyloctane;yttrium.
Molecular Properties
| Compound Name | 4-ethyloctane;yttrium |
| PubChem CID | 59895669 |
| Molecular Formula | C10H21Y- |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-ethyloctane;yttrium |
| SMILES | [CH2-]CCC(CC)CCCC.[Y] |
| InChI | InChI=1S/C10H21.Y/c1-4-7-9-10(6-3)8-5-2;/h10H,2,4-9H2,1,3H3;/q-1; |
| InChIKey | JNUADZYYASUXMY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyloctane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyloctane;yttrium?
The IUPAC name of 4-ethyloctane;yttrium (CID 59895669) is 4-ethyloctane;yttrium.
What is the SMILES notation for 4-ethyloctane;yttrium?
The canonical SMILES for 4-ethyloctane;yttrium is [CH2-]CCC(CC)CCCC.[Y].
What is the InChIKey of 4-ethyloctane;yttrium?
The InChIKey is JNUADZYYASUXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21.Y/c1-4-7-9-10(6-3)8-5-2;/h10H,2,4-9H2,1,3H3;/q-1;.
What are the key properties of 4-ethyloctane;yttrium?
4-ethyloctane;yttrium has a molecular weight of 230.18 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyloctane;yttrium is sourced from PubChem (CID 59895669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).