C35H26BeN2O2+2 — CID 59896287
beryllium;benzo[h]quinolin-1-ium-10-olate;7-(4-prop-1-enylphenyl)benzo[h]quinolin-1-ium-10-olate (PubChem CID 59896287) has the molecular formula C35H26BeN2O2+2 and a molecular weight of 515.62 g/mol. Its IUPAC name is beryllium;benzo[h]quinolin-1-ium-10-olate;7-(4-prop-1-enylphenyl)benzo[h]quinolin-1-ium-10-olate.
| Compound Name | beryllium;benzo[h]quinolin-1-ium-10-olate;7-(4-prop-1-enylphenyl)benzo[h]quinolin-1-ium-10-olate |
|---|---|
| PubChem CID | 59896287 |
| Molecular Formula | C35H26BeN2O2+2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | beryllium;benzo[h]quinolin-1-ium-10-olate;7-(4-prop-1-enylphenyl)benzo[h]quinolin-1-ium-10-olate |
| SMILES | CC=Cc1ccc(-c2ccc([O-])c3c2ccc2ccc[nH+]c23)cc1.[Be+2].[O-]c1cccc2ccc3ccc[nH+]c3c12 |
| InChI | InChI=1S/C22H17NO.C13H9NO.Be/c1-2-4-15-6-8-16(9-7-15)18-12-13-20(24)21-19(18)11-10-17-5-3-14-23-22(17)21;15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;/h2-14,24H,1H3;1-8,15H;/q;;+2 |
| InChIKey | XRXRUMNLHZYLNG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|