C14H12 — CID 59901506
(E)-6-ethyl-5-methylundec-5-en-1,3,7,9-tetrayne (PubChem CID 59901506) has the molecular formula C14H12 and a molecular weight of 180.25 g/mol. Its IUPAC name is (E)-6-ethyl-5-methylundec-5-en-1,3,7,9-tetrayne.
| Compound Name | (E)-6-ethyl-5-methylundec-5-en-1,3,7,9-tetrayne |
|---|---|
| PubChem CID | 59901506 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (E)-6-ethyl-5-methylundec-5-en-1,3,7,9-tetrayne |
| SMILES | C#CC#C/C(C)=C(/C#CC#CC)CC |
| InChI | InChI=1S/C14H12/c1-5-8-10-12-14(7-3)13(4)11-9-6-2/h2H,7H2,1,3-4H3/b14-13+ |
| InChIKey | HGQIEJZJHADLIV-BUHFOSPRSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|