C26H28N4O5 — CID 59901565
N-[(2S,4S)-5-(hydroxyamino)-1-(methoxymethoxy)-4-methyl-5-oxopentan-2-yl]-4-[2-(4-imidazol-1-ylphenyl)ethynyl]benzamide (PubChem CID 59901565) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-[(2S,4S)-5-(hydroxyamino)-1-(methoxymethoxy)-4-methyl-5-oxopentan-2-yl]-4-[2-(4-imidazol-1-ylphenyl)ethynyl]benzamide.
| Compound Name | N-[(2S,4S)-5-(hydroxyamino)-1-(methoxymethoxy)-4-methyl-5-oxopentan-2-yl]-4-[2-(4-imidazol-1-ylphenyl)ethynyl]benzamide |
|---|---|
| PubChem CID | 59901565 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-[(2S,4S)-5-(hydroxyamino)-1-(methoxymethoxy)-4-methyl-5-oxopentan-2-yl]-4-[2-(4-imidazol-1-ylphenyl)ethynyl]benzamide |
| SMILES | COCOC[C@H](C[C@H](C)C(=O)NO)NC(=O)c1ccc(C#Cc2ccc(-n3ccnc3)cc2)cc1 |
| InChI | InChI=1S/C26H28N4O5/c1-19(25(31)29-33)15-23(16-35-18-34-2)28-26(32)22-9-5-20(6-10-22)3-4-21-7-11-24(12-8-21)30-14-13-27-17-30/h5-14,17,19,23,33H,15-16,18H2,1-2H3,(H,28,32)(H,29,31)/t19-,23-/m0/s1 |
| InChIKey | IMGFXRVRYZOBST-CVDCTZTESA-N |
| XLogP | 2.52 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|