C33H36N2O7S3+2 — CID 59902169
5,6-dimethyl-2-[(2E)-2-[[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonic acid (PubChem CID 59902169) has the molecular formula C33H36N2O7S3+2 and a molecular weight of 668.86 g/mol. Its IUPAC name is 5,6-dimethyl-2-[(2E)-2-[[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonic acid.
| Compound Name | 5,6-dimethyl-2-[(2E)-2-[[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonic acid |
|---|---|
| PubChem CID | 59902169 |
| Molecular Formula | C33H36N2O7S3+2 |
| Molecular Weight | 668.86 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | 5,6-dimethyl-2-[(2E)-2-[[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonic acid |
| SMILES | CC/C(C=C1Sc2cc(C)c(C)cc2[N+]12CCCC2S(=O)(=O)O)=C\c1oc2ccc(-c3ccccc3)cc2[n+]1CCS(=O)(=O)O |
| InChI | InChI=1S/C33H34N2O7S3/c1-4-24(20-32-35(15-8-11-33(35)45(39,40)41)28-17-22(2)23(3)18-30(28)43-32)19-31-34(14-16-44(36,37)38)27-21-26(12-13-29(27)42-31)25-9-6-5-7-10-25/h5-7,9-10,12-13,17-21,33H,4,8,11,14-16H2,1-3H3/p+2/b24-19+,32-20? |
| InChIKey | LLLRSRZONPWPHS-NHGASEPHSA-P |
| XLogP | 6.65 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.86 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|