C12H14Cl2N2O2 — CID 59902539
(2S)-1-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-(methylamino)butan-1-ol (PubChem CID 59902539) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is (2S)-1-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-(methylamino)butan-1-ol.
| Compound Name | (2S)-1-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-(methylamino)butan-1-ol |
|---|---|
| PubChem CID | 59902539 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (2S)-1-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-(methylamino)butan-1-ol |
| SMILES | CC[C@H](NC)C(O)c1nc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C12H14Cl2N2O2/c1-3-8(15-2)10(17)12-16-9-5-6(13)4-7(14)11(9)18-12/h4-5,8,10,15,17H,3H2,1-2H3/t8-,10?/m0/s1 |
| InChIKey | XMBKPROBMCNWAN-PEHGTWAWSA-N |
| XLogP | 3.17 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |