C11H10Cl2N2O3 — CID 122048793
2-[(5,7-dichloro-1,3-benzoxazol-2-yl)-methylamino]propanoic acid (PubChem CID 122048793) has the molecular formula C11H10Cl2N2O3 and a molecular weight of 289.12 g/mol. Its IUPAC name is 2-[(5,7-dichloro-1,3-benzoxazol-2-yl)-methylamino]propanoic acid.
| Compound Name | 2-[(5,7-dichloro-1,3-benzoxazol-2-yl)-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122048793 |
| Molecular Formula | C11H10Cl2N2O3 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-[(5,7-dichloro-1,3-benzoxazol-2-yl)-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)c1nc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C11H10Cl2N2O3/c1-5(10(16)17)15(2)11-14-8-4-6(12)3-7(13)9(8)18-11/h3-5H,1-2H3,(H,16,17) |
| InChIKey | LTTUMORWLBWUJP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |