1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid

C11H8Cl2N2O3 — CID 122064411

IUPAC1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid
SMILESO=C(O)C1CN(c2nc3cc(Cl)cc(Cl)c3o2)C1
InChIInChI=1S/C11H8Cl2N2O3/c12-6-1-7(13)9-8(2-6)14-11(18-9)15-3-5(4-15)10(16)17/h1-2,5H,3-4H2,(H,16,17)
InChIKeyMLYPBPMAICNSET-UHFFFAOYSA-N
MW287.10 g/mol
LogP2.66
Rot. Bonds2

About 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid

1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid (PubChem CID 122064411) has the molecular formula C11H8Cl2N2O3 and a molecular weight of 287.10 g/mol. Its IUPAC name is 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid
PubChem CID122064411
Molecular FormulaC11H8Cl2N2O3
Molecular Weight287.10 g/mol
Exact Mass285.99
IUPAC Name1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid
SMILESO=C(O)C1CN(c2nc3cc(Cl)cc(Cl)c3o2)C1
InChIInChI=1S/C11H8Cl2N2O3/c12-6-1-7(13)9-8(2-6)14-11(18-9)15-3-5(4-15)10(16)17/h1-2,5H,3-4H2,(H,16,17)
InChIKeyMLYPBPMAICNSET-UHFFFAOYSA-N
XLogP2.66
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.10
LogP ≤ 52.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid?
The IUPAC name of 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid (CID 122064411) is 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid.
What is the SMILES notation for 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid?
The canonical SMILES for 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid is O=C(O)C1CN(c2nc3cc(Cl)cc(Cl)c3o2)C1.
What is the InChIKey of 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid?
The InChIKey is MLYPBPMAICNSET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2N2O3/c12-6-1-7(13)9-8(2-6)14-11(18-9)15-3-5(4-15)10(16)17/h1-2,5H,3-4H2,(H,16,17).
What are the key properties of 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid?
1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid has a molecular weight of 287.10 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,7-dichloro-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid is sourced from PubChem (CID 122064411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).