C12H11Cl2NO3 — CID 107675982
3-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylbutanoic acid (PubChem CID 107675982) has the molecular formula C12H11Cl2NO3 and a molecular weight of 288.13 g/mol. Its IUPAC name is 3-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylbutanoic acid.
| Compound Name | 3-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 107675982 |
| Molecular Formula | C12H11Cl2NO3 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylbutanoic acid |
| SMILES | CC(C(=O)O)C(C)c1nc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C12H11Cl2NO3/c1-5(6(2)12(16)17)11-15-9-4-7(13)3-8(14)10(9)18-11/h3-6H,1-2H3,(H,16,17) |
| InChIKey | TZJPQPIVZNZEFK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |