C12H21Cl7N3OP — CID 173248750
5,7-dichloro-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;phosphane;pentahydrochloride (PubChem CID 173248750) has the molecular formula C12H21Cl7N3OP and a molecular weight of 502.47 g/mol. Its IUPAC name is 5,7-dichloro-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;phosphane;pentahydrochloride.
| Compound Name | 5,7-dichloro-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;phosphane;pentahydrochloride |
|---|---|
| PubChem CID | 173248750 |
| Molecular Formula | C12H21Cl7N3OP |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 498.92 |
| IUPAC Name | 5,7-dichloro-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;phosphane;pentahydrochloride |
| SMILES | CN1CCN(c2nc3cc(Cl)cc(Cl)c3o2)CC1.Cl.Cl.Cl.Cl.Cl.P |
| InChI | InChI=1S/C12H13Cl2N3O.5ClH.H3P/c1-16-2-4-17(5-3-16)12-15-10-7-8(13)6-9(14)11(10)18-12;;;;;;/h6-7H,2-5H2,1H3;5*1H;1H3 |
| InChIKey | KOMGORQSAXIRNG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|