C12H13N11O3 — CID 59902837
(5R)-2-(6-azido-2-methylpurin-9-yl)-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 59902837) has the molecular formula C12H13N11O3 and a molecular weight of 359.31 g/mol. Its IUPAC name is (5R)-2-(6-azido-2-methylpurin-9-yl)-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | (5R)-2-(6-azido-2-methylpurin-9-yl)-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59902837 |
| Molecular Formula | C12H13N11O3 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (5R)-2-(6-azido-2-methylpurin-9-yl)-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | Cc1nc(N=[N+]=[N-])c2ncn(C3O[C@H](c4nnn(C)n4)C(O)C3O)c2n1 |
| InChI | InChI=1S/C12H13N11O3/c1-4-15-9(17-20-13)5-11(16-4)23(3-14-5)12-7(25)6(24)8(26-12)10-18-21-22(2)19-10/h3,6-8,12,24-25H,1-2H3/t6?,7?,8-,12?/m0/s1 |
| InChIKey | UZYCYYKMZNVODU-VBCXJGGRSA-N |
| XLogP | -0.41 |
| TPSA | 185.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|