C11H13N5O4S — CID 88829423
(2R,3R,4S,5S)-2-(2-methyl-6-nitrosopurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol (PubChem CID 88829423) has the molecular formula C11H13N5O4S and a molecular weight of 311.32 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(2-methyl-6-nitrosopurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(2-methyl-6-nitrosopurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 88829423 |
| Molecular Formula | C11H13N5O4S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (2R,3R,4S,5S)-2-(2-methyl-6-nitrosopurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol |
| SMILES | Cc1nc(N=O)c2ncn([C@@H]3O[C@H](CS)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C11H13N5O4S/c1-4-13-9(15-19)6-10(14-4)16(3-12-6)11-8(18)7(17)5(2-21)20-11/h3,5,7-8,11,17-18,21H,2H2,1H3/t5-,7-,8-,11-/m1/s1 |
| InChIKey | ISDWELZVANJMIB-IOSLPCCCSA-N |
| XLogP | 0.08 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|