C28H38N2O5Si — CID 59904113
(2,5-dioxopyrrolidin-1-yl) 2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(methylamino)-4-phenylbutyl]benzoate (PubChem CID 59904113) has the molecular formula C28H38N2O5Si and a molecular weight of 510.71 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(methylamino)-4-phenylbutyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(methylamino)-4-phenylbutyl]benzoate |
|---|---|
| PubChem CID | 59904113 |
| Molecular Formula | C28H38N2O5Si |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(methylamino)-4-phenylbutyl]benzoate |
| SMILES | CNC(Cc1ccccc1)[C@@H](Cc1ccccc1C(=O)ON1C(=O)CCC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H38N2O5Si/c1-28(2,3)36(5,6)35-24(23(29-4)18-20-12-8-7-9-13-20)19-21-14-10-11-15-22(21)27(33)34-30-25(31)16-17-26(30)32/h7-15,23-24,29H,16-19H2,1-6H3/t23?,24-/m1/s1 |
| InChIKey | PZGKSLWUHWIHHF-XMMISQBUSA-N |
| XLogP | 4.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|