C30H46BNO4Si2 — CID 59904123
CID 59904123 (PubChem CID 59904123) has the molecular formula C30H46BNO4Si2 and a molecular weight of 551.69 g/mol.
| Compound Name | CID 59904123 |
|---|---|
| PubChem CID | 59904123 |
| Molecular Formula | C30H46BNO4Si2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NC(Cc1ccccc1)[C@@H](Cc1ccccc1C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H46BNO4Si2/c1-29(2,3)37(7,8)35-26(25(32-28(31)34)20-22-16-12-11-13-17-22)21-23-18-14-15-19-24(23)27(33)36-38(9,10)30(4,5)6/h11-19,25-26H,20-21H2,1-10H3,(H,32,34)/t25?,26-/m1/s1 |
| InChIKey | AXSUTKYNMSVEFS-FXDYGKIASA-N |
| XLogP | 7.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|