C44H64F2N2O4 — CID 59906804
(Z)-2-[4-[1-cyano-2-(3-fluoro-2,5-dihexoxy-4-methylphenyl)ethyl]-3-fluoro-2,5-dihexoxyphenyl]but-2-enenitrile (PubChem CID 59906804) has the molecular formula C44H64F2N2O4 and a molecular weight of 723.00 g/mol. Its IUPAC name is (Z)-2-[4-[1-cyano-2-(3-fluoro-2,5-dihexoxy-4-methylphenyl)ethyl]-3-fluoro-2,5-dihexoxyphenyl]but-2-enenitrile.
| Compound Name | (Z)-2-[4-[1-cyano-2-(3-fluoro-2,5-dihexoxy-4-methylphenyl)ethyl]-3-fluoro-2,5-dihexoxyphenyl]but-2-enenitrile |
|---|---|
| PubChem CID | 59906804 |
| Molecular Formula | C44H64F2N2O4 |
| Molecular Weight | 723.00 g/mol |
| Exact Mass | 722.48 |
| IUPAC Name | (Z)-2-[4-[1-cyano-2-(3-fluoro-2,5-dihexoxy-4-methylphenyl)ethyl]-3-fluoro-2,5-dihexoxyphenyl]but-2-enenitrile |
| SMILES | C/C=C(\C#N)c1cc(OCCCCCC)c(C(C#N)Cc2cc(OCCCCCC)c(C)c(F)c2OCCCCCC)c(F)c1OCCCCCC |
| InChI | InChI=1S/C44H64F2N2O4/c1-7-12-16-20-24-49-38-29-35(43(41(45)33(38)6)51-26-22-18-14-9-3)28-36(32-48)40-39(50-25-21-17-13-8-2)30-37(34(11-5)31-47)44(42(40)46)52-27-23-19-15-10-4/h11,29-30,36H,7-10,12-28H2,1-6H3/b34-11+ |
| InChIKey | MFVCJYAQEFERTC-WHQPAHRZSA-N |
| XLogP | 12.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.00 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|