C34H44N2O2 — CID 58282390
(Z)-2-[2-hexoxy-4-[(Z)-2-(2-hexoxy-4,5-dimethylphenyl)-1-isocyanoethenyl]-5-methylphenyl]but-2-enenitrile (PubChem CID 58282390) has the molecular formula C34H44N2O2 and a molecular weight of 512.74 g/mol. Its IUPAC name is (Z)-2-[2-hexoxy-4-[(Z)-2-(2-hexoxy-4,5-dimethylphenyl)-1-isocyanoethenyl]-5-methylphenyl]but-2-enenitrile.
| Compound Name | (Z)-2-[2-hexoxy-4-[(Z)-2-(2-hexoxy-4,5-dimethylphenyl)-1-isocyanoethenyl]-5-methylphenyl]but-2-enenitrile |
|---|---|
| PubChem CID | 58282390 |
| Molecular Formula | C34H44N2O2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | (Z)-2-[2-hexoxy-4-[(Z)-2-(2-hexoxy-4,5-dimethylphenyl)-1-isocyanoethenyl]-5-methylphenyl]but-2-enenitrile |
| SMILES | [C-]#[N+]/C(=C\c1cc(C)c(C)cc1OCCCCCC)c1cc(OCCCCCC)c(/C(C#N)=C/C)cc1C |
| InChI | InChI=1S/C34H44N2O2/c1-8-11-13-15-17-37-33-21-26(5)25(4)19-29(33)22-32(36-7)30-23-34(38-18-16-14-12-9-2)31(20-27(30)6)28(10-3)24-35/h10,19-23H,8-9,11-18H2,1-6H3/b28-10+,32-22- |
| InChIKey | STQYMLWEAVGHNJ-HMAXJQFMSA-N |
| XLogP | 9.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|