C50H67N3O2 — CID 58835633
(Z)-2-[7-[(Z)-1-isocyanoprop-1-enyl]-9-octylcarbazol-2-yl]-3-(4-methyl-2,5-dioctoxyphenyl)prop-2-enenitrile (PubChem CID 58835633) has the molecular formula C50H67N3O2 and a molecular weight of 742.10 g/mol. Its IUPAC name is (Z)-2-[7-[(Z)-1-isocyanoprop-1-enyl]-9-octylcarbazol-2-yl]-3-(4-methyl-2,5-dioctoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[7-[(Z)-1-isocyanoprop-1-enyl]-9-octylcarbazol-2-yl]-3-(4-methyl-2,5-dioctoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 58835633 |
| Molecular Formula | C50H67N3O2 |
| Molecular Weight | 742.10 g/mol |
| Exact Mass | 741.52 |
| IUPAC Name | (Z)-2-[7-[(Z)-1-isocyanoprop-1-enyl]-9-octylcarbazol-2-yl]-3-(4-methyl-2,5-dioctoxyphenyl)prop-2-enenitrile |
| SMILES | [C-]#[N+]/C(=C\C)c1ccc2c3ccc(/C(C#N)=C/c4cc(OCCCCCCCC)c(C)cc4OCCCCCCCC)cc3n(CCCCCCCC)c2c1 |
| InChI | InChI=1S/C50H67N3O2/c1-7-11-14-17-20-23-30-53-47-35-40(26-28-44(47)45-29-27-41(36-48(45)53)46(10-4)52-6)43(38-51)34-42-37-49(54-31-24-21-18-15-12-8-2)39(5)33-50(42)55-32-25-22-19-16-13-9-3/h10,26-29,33-37H,7-9,11-25,30-32H2,1-5H3/b43-34+,46-10- |
| InChIKey | AUDQNEGIRCIHOB-ZDUKDITNSA-N |
| XLogP | 15.29 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.10 |
| LogP ≤ 5 | 15.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|