C44H42F2N2O2S2 — CID 132936895
(E)-3-[4-[(E)-2-cyano-2-[5-(4-fluorophenyl)thiophen-2-yl]ethenyl]-2,5-dihexoxyphenyl]-2-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enenitrile (PubChem CID 132936895) has the molecular formula C44H42F2N2O2S2 and a molecular weight of 732.96 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-cyano-2-[5-(4-fluorophenyl)thiophen-2-yl]ethenyl]-2,5-dihexoxyphenyl]-2-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(E)-2-cyano-2-[5-(4-fluorophenyl)thiophen-2-yl]ethenyl]-2,5-dihexoxyphenyl]-2-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 132936895 |
| Molecular Formula | C44H42F2N2O2S2 |
| Molecular Weight | 732.96 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | (E)-3-[4-[(E)-2-cyano-2-[5-(4-fluorophenyl)thiophen-2-yl]ethenyl]-2,5-dihexoxyphenyl]-2-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enenitrile |
| SMILES | CCCCCCOc1cc(/C=C(\C#N)c2ccc(-c3ccc(F)cc3)s2)c(OCCCCCC)cc1/C=C(\C#N)c1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C44H42F2N2O2S2/c1-3-5-7-9-23-49-39-27-34(26-36(30-48)44-22-20-42(52-44)32-13-17-38(46)18-14-32)40(50-24-10-8-6-4-2)28-33(39)25-35(29-47)43-21-19-41(51-43)31-11-15-37(45)16-12-31/h11-22,25-28H,3-10,23-24H2,1-2H3/b35-25+,36-26+ |
| InChIKey | IVDXJFGUVJANPJ-DKKRNIPZSA-N |
| XLogP | 13.47 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.96 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|