C16H14FNO3S — CID 71194332
5-(4-butoxy-3-cyano-5-fluorophenyl)thiophene-2-carboxylic acid (PubChem CID 71194332) has the molecular formula C16H14FNO3S and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-(4-butoxy-3-cyano-5-fluorophenyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-butoxy-3-cyano-5-fluorophenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 71194332 |
| Molecular Formula | C16H14FNO3S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 5-(4-butoxy-3-cyano-5-fluorophenyl)thiophene-2-carboxylic acid |
| SMILES | CCCCOc1c(F)cc(-c2ccc(C(=O)O)s2)cc1C#N |
| InChI | InChI=1S/C16H14FNO3S/c1-2-3-6-21-15-11(9-18)7-10(8-12(15)17)13-4-5-14(22-13)16(19)20/h4-5,7-8H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | IRXPXOYELBBHRB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|