C15H12NNaO3S — CID 69010000
sodium 5-(3-cyano-4-propoxyphenyl)thiophene-2-carboxylate (PubChem CID 69010000) has the molecular formula C15H12NNaO3S and a molecular weight of 309.32 g/mol. Its IUPAC name is sodium 5-(3-cyano-4-propoxyphenyl)thiophene-2-carboxylate.
| Compound Name | sodium 5-(3-cyano-4-propoxyphenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 69010000 |
| Molecular Formula | C15H12NNaO3S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | sodium 5-(3-cyano-4-propoxyphenyl)thiophene-2-carboxylate |
| SMILES | CCCOc1ccc(-c2ccc(C(=O)[O-])s2)cc1C#N.[Na+] |
| InChI | InChI=1S/C15H13NO3S.Na/c1-2-7-19-12-4-3-10(8-11(12)9-16)13-5-6-14(20-13)15(17)18;/h3-6,8H,2,7H2,1H3,(H,17,18);/q;+1/p-1 |
| InChIKey | BJUFDVIZDLTPSS-UHFFFAOYSA-M |
| XLogP | -0.56 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |