C42H60N2O4 — CID 121276422
(Z)-2-[4-[(Z)-1-cyano-2-[5-(3,7-dimethyloctoxy)-2-methoxy-4-methylphenyl]ethenyl]-5-(3,7-dimethyloctoxy)-2-(hydroxymethyl)phenyl]but-2-enenitrile (PubChem CID 121276422) has the molecular formula C42H60N2O4 and a molecular weight of 656.95 g/mol. Its IUPAC name is (Z)-2-[4-[(Z)-1-cyano-2-[5-(3,7-dimethyloctoxy)-2-methoxy-4-methylphenyl]ethenyl]-5-(3,7-dimethyloctoxy)-2-(hydroxymethyl)phenyl]but-2-enenitrile.
| Compound Name | (Z)-2-[4-[(Z)-1-cyano-2-[5-(3,7-dimethyloctoxy)-2-methoxy-4-methylphenyl]ethenyl]-5-(3,7-dimethyloctoxy)-2-(hydroxymethyl)phenyl]but-2-enenitrile |
|---|---|
| PubChem CID | 121276422 |
| Molecular Formula | C42H60N2O4 |
| Molecular Weight | 656.95 g/mol |
| Exact Mass | 656.46 |
| IUPAC Name | (Z)-2-[4-[(Z)-1-cyano-2-[5-(3,7-dimethyloctoxy)-2-methoxy-4-methylphenyl]ethenyl]-5-(3,7-dimethyloctoxy)-2-(hydroxymethyl)phenyl]but-2-enenitrile |
| SMILES | C/C=C(\C#N)c1cc(OCCC(C)CCCC(C)C)c(/C(C#N)=C/c2cc(OCCC(C)CCCC(C)C)c(C)cc2OC)cc1CO |
| InChI | InChI=1S/C42H60N2O4/c1-10-34(26-43)38-25-42(48-20-18-32(7)16-12-14-30(4)5)39(23-37(38)28-45)36(27-44)22-35-24-40(33(8)21-41(35)46-9)47-19-17-31(6)15-11-13-29(2)3/h10,21-25,29-32,45H,11-20,28H2,1-9H3/b34-10+,36-22+ |
| InChIKey | RKRKOTVYUGSFPT-RRNVMMDWSA-N |
| XLogP | 10.95 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.95 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|