C25H39F3O5Si — CID 59916240
tert-butyl-[4-[(2R,3S,4S,5S)-5-ethenyl-3-methoxy-4-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-1,1,1-trifluorobutan-2-yl]oxy-dimethylsilane (PubChem CID 59916240) has the molecular formula C25H39F3O5Si and a molecular weight of 504.66 g/mol. Its IUPAC name is tert-butyl-[4-[(2R,3S,4S,5S)-5-ethenyl-3-methoxy-4-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-1,1,1-trifluorobutan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[4-[(2R,3S,4S,5S)-5-ethenyl-3-methoxy-4-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-1,1,1-trifluorobutan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 59916240 |
| Molecular Formula | C25H39F3O5Si |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | tert-butyl-[4-[(2R,3S,4S,5S)-5-ethenyl-3-methoxy-4-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-1,1,1-trifluorobutan-2-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H]1O[C@H](CCC(O[Si](C)(C)C(C)(C)C)C(F)(F)F)[C@H](OC)[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H39F3O5Si/c1-9-19-23(31-16-17-10-12-18(29-5)13-11-17)22(30-6)20(32-19)14-15-21(25(26,27)28)33-34(7,8)24(2,3)4/h9-13,19-23H,1,14-16H2,2-8H3/t19-,20+,21?,22-,23-/m0/s1 |
| InChIKey | GNMYXLFHMKDVHT-LYNUFONESA-N |
| XLogP | 6.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|