C16H21N2OY- — CID 59916292
N-(2-cyano-3-methylbutan-2-yl)-2-(2-methylbenzene-6-id-1-yl)propanamide;yttrium (PubChem CID 59916292) has the molecular formula C16H21N2OY- and a molecular weight of 346.26 g/mol. Its IUPAC name is N-(2-cyano-3-methylbutan-2-yl)-2-(2-methylbenzene-6-id-1-yl)propanamide;yttrium.
| Compound Name | N-(2-cyano-3-methylbutan-2-yl)-2-(2-methylbenzene-6-id-1-yl)propanamide;yttrium |
|---|---|
| PubChem CID | 59916292 |
| Molecular Formula | C16H21N2OY- |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N-(2-cyano-3-methylbutan-2-yl)-2-(2-methylbenzene-6-id-1-yl)propanamide;yttrium |
| SMILES | Cc1ccc[c-]c1C(C)C(=O)NC(C)(C#N)C(C)C.[Y] |
| InChI | InChI=1S/C16H21N2O.Y/c1-11(2)16(5,10-17)18-15(19)13(4)14-9-7-6-8-12(14)3;/h6-8,11,13H,1-5H3,(H,18,19);/q-1; |
| InChIKey | CAYUKHGEMOHZBP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|