C17H16O3S3 — CID 59919945
(2R)-2-(hydroxymethyl)-5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]oxolan-3-ol (PubChem CID 59919945) has the molecular formula C17H16O3S3 and a molecular weight of 364.51 g/mol. Its IUPAC name is (2R)-2-(hydroxymethyl)-5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]oxolan-3-ol.
| Compound Name | (2R)-2-(hydroxymethyl)-5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 59919945 |
| Molecular Formula | C17H16O3S3 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (2R)-2-(hydroxymethyl)-5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]oxolan-3-ol |
| SMILES | OC[C@H]1OC(c2ccc(-c3ccc(-c4cccs4)s3)s2)CC1O |
| InChI | InChI=1S/C17H16O3S3/c18-9-12-10(19)8-11(20-12)13-3-4-16(22-13)17-6-5-15(23-17)14-2-1-7-21-14/h1-7,10-12,18-19H,8-9H2/t10?,11?,12-/m1/s1 |
| InChIKey | OQHSWDWBMINFQO-HTAVTVPLSA-N |
| XLogP | 4.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |