C8H11NO4S — CID 13009538
(2R,3S,5R)-2-(hydroxymethyl)-5-(3-oxido-1,3-thiazol-3-ium-2-yl)oxolan-3-ol (PubChem CID 13009538) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is (2R,3S,5R)-2-(hydroxymethyl)-5-(3-oxido-1,3-thiazol-3-ium-2-yl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-(hydroxymethyl)-5-(3-oxido-1,3-thiazol-3-ium-2-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 13009538 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (2R,3S,5R)-2-(hydroxymethyl)-5-(3-oxido-1,3-thiazol-3-ium-2-yl)oxolan-3-ol |
| SMILES | [O-][n+]1ccsc1[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C8H11NO4S/c10-4-7-5(11)3-6(13-7)8-9(12)1-2-14-8/h1-2,5-7,10-11H,3-4H2/t5-,6+,7+/m0/s1 |
| InChIKey | YXDHXSLXXRBJAL-RRKCRQDMSA-N |
| XLogP | -0.44 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|