C19H27NO4 — CID 59922392
(3R,4R,5R)-5-[[benzyl(methyl)amino]methyl]-4-methoxy-2-pent-2-ynoxyoxolan-3-ol (PubChem CID 59922392) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (3R,4R,5R)-5-[[benzyl(methyl)amino]methyl]-4-methoxy-2-pent-2-ynoxyoxolan-3-ol.
| Compound Name | (3R,4R,5R)-5-[[benzyl(methyl)amino]methyl]-4-methoxy-2-pent-2-ynoxyoxolan-3-ol |
|---|---|
| PubChem CID | 59922392 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (3R,4R,5R)-5-[[benzyl(methyl)amino]methyl]-4-methoxy-2-pent-2-ynoxyoxolan-3-ol |
| SMILES | CCC#CCOC1O[C@H](CN(C)Cc2ccccc2)[C@H](OC)[C@H]1O |
| InChI | InChI=1S/C19H27NO4/c1-4-5-9-12-23-19-17(21)18(22-3)16(24-19)14-20(2)13-15-10-7-6-8-11-15/h6-8,10-11,16-19,21H,4,12-14H2,1-3H3/t16-,17-,18+,19?/m1/s1 |
| InChIKey | CXWQRMVOLGDDLQ-KAKFPZCNSA-N |
| XLogP | 1.65 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|