C16H19I9O5 — CID 59927347
6-ethyl-4-methoxycarbonyl-2-methyl-7-oxo-2,4,6-tris(triiodomethyl)octanoic acid (PubChem CID 59927347) has the molecular formula C16H19I9O5 and a molecular weight of 1433.46 g/mol. Its IUPAC name is 6-ethyl-4-methoxycarbonyl-2-methyl-7-oxo-2,4,6-tris(triiodomethyl)octanoic acid.
| Compound Name | 6-ethyl-4-methoxycarbonyl-2-methyl-7-oxo-2,4,6-tris(triiodomethyl)octanoic acid |
|---|---|
| PubChem CID | 59927347 |
| Molecular Formula | C16H19I9O5 |
| Molecular Weight | 1433.46 g/mol |
| Exact Mass | 1433.26 |
| IUPAC Name | 6-ethyl-4-methoxycarbonyl-2-methyl-7-oxo-2,4,6-tris(triiodomethyl)octanoic acid |
| SMILES | CCC(CC(CC(C)(C(=O)O)C(I)(I)I)(C(=O)OC)C(I)(I)I)(C(C)=O)C(I)(I)I |
| InChI | InChI=1S/C16H19I9O5/c1-5-12(8(2)26,15(20,21)22)7-13(10(29)30-4,16(23,24)25)6-11(3,9(27)28)14(17,18)19/h5-7H2,1-4H3,(H,27,28) |
| InChIKey | KNKIHUBPQFCGEZ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1433.46 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|