C25H44 — CID 59927394
5-[4-[4-[(E)-but-2-enyl]cyclohexyl]cyclohexyl]-1,2,3-trimethylcyclohexane (PubChem CID 59927394) has the molecular formula C25H44 and a molecular weight of 344.63 g/mol. Its IUPAC name is 5-[4-[4-[(E)-but-2-enyl]cyclohexyl]cyclohexyl]-1,2,3-trimethylcyclohexane.
| Compound Name | 5-[4-[4-[(E)-but-2-enyl]cyclohexyl]cyclohexyl]-1,2,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 59927394 |
| Molecular Formula | C25H44 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | 5-[4-[4-[(E)-but-2-enyl]cyclohexyl]cyclohexyl]-1,2,3-trimethylcyclohexane |
| SMILES | C/C=C/CC1CCC(C2CCC(C3CC(C)C(C)C(C)C3)CC2)CC1 |
| InChI | InChI=1S/C25H44/c1-5-6-7-21-8-10-22(11-9-21)23-12-14-24(15-13-23)25-16-18(2)20(4)19(3)17-25/h5-6,18-25H,7-17H2,1-4H3/b6-5+ |
| InChIKey | LSCVEPFKPPTVNO-AATRIKPKSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|