C9H16AcNO4- — CID 59928041
actinium;[(2R,5R)-5-hydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]azanide (PubChem CID 59928041) has the molecular formula C9H16AcNO4- and a molecular weight of 429.23 g/mol. Its IUPAC name is actinium;[(2R,5R)-5-hydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]azanide.
| Compound Name | actinium;[(2R,5R)-5-hydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]azanide |
|---|---|
| PubChem CID | 59928041 |
| Molecular Formula | C9H16AcNO4- |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | actinium;[(2R,5R)-5-hydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]azanide |
| SMILES | C=CCO[C@@H]1OC(CO)[C@H](O)CC1[NH-].[Ac] |
| InChI | InChI=1S/C9H16NO4.Ac/c1-2-3-13-9-6(10)4-7(12)8(5-11)14-9;/h2,6-12H,1,3-5H2;/q-1;/t6?,7-,8?,9-;/m1./s1 |
| InChIKey | HYHGGQLJRLHVBU-CFMJTGTKSA-N |
| XLogP | 0.08 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|