C27H55N3O — CID 59931013
3-butyl-3-cyclohexyl-N,N-bis[3-(dimethylamino)propyl]heptanamide (PubChem CID 59931013) has the molecular formula C27H55N3O and a molecular weight of 437.76 g/mol. Its IUPAC name is 3-butyl-3-cyclohexyl-N,N-bis[3-(dimethylamino)propyl]heptanamide.
| Compound Name | 3-butyl-3-cyclohexyl-N,N-bis[3-(dimethylamino)propyl]heptanamide |
|---|---|
| PubChem CID | 59931013 |
| Molecular Formula | C27H55N3O |
| Molecular Weight | 437.76 g/mol |
| Exact Mass | 437.43 |
| IUPAC Name | 3-butyl-3-cyclohexyl-N,N-bis[3-(dimethylamino)propyl]heptanamide |
| SMILES | CCCCC(CCCC)(CC(=O)N(CCCN(C)C)CCCN(C)C)C1CCCCC1 |
| InChI | InChI=1S/C27H55N3O/c1-7-9-18-27(19-10-8-2,25-16-12-11-13-17-25)24-26(31)30(22-14-20-28(3)4)23-15-21-29(5)6/h25H,7-24H2,1-6H3 |
| InChIKey | OGKIBNALAUPBFV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |