C21H28FY- — CID 59931312
1-fluoro-3-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]benzene-6-ide;yttrium (PubChem CID 59931312) has the molecular formula C21H28FY- and a molecular weight of 388.36 g/mol. Its IUPAC name is 1-fluoro-3-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]benzene-6-ide;yttrium.
| Compound Name | 1-fluoro-3-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]benzene-6-ide;yttrium |
|---|---|
| PubChem CID | 59931312 |
| Molecular Formula | C21H28FY- |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-fluoro-3-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]benzene-6-ide;yttrium |
| SMILES | CC1CCC(/C=C/C2CCC(c3cc[c-]c(F)c3)CC2)CC1.[Y] |
| InChI | InChI=1S/C21H28F.Y/c1-16-5-7-17(8-6-16)9-10-18-11-13-19(14-12-18)20-3-2-4-21(22)15-20;/h2-3,9-10,15-19H,5-8,11-14H2,1H3;/q-1;/b10-9+; |
| InChIKey | VKZROZYHTWYKOA-RRABGKBLSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|