About 2-oxopropyliminoazanide
2-oxopropyliminoazanide (PubChem CID 59937174) has the molecular formula C3H5N2O-
and a molecular weight of 85.09 g/mol. Its IUPAC name is 2-oxopropyliminoazanide.
Molecular Properties
| Compound Name | 2-oxopropyliminoazanide |
| PubChem CID | 59937174 |
| Molecular Formula | C3H5N2O- |
| Molecular Weight | 85.09 g/mol |
| Exact Mass | 85.04 |
| IUPAC Name | 2-oxopropyliminoazanide |
| SMILES | CC(=O)CN=[N-] |
| InChI | InChI=1S/C3H5N2O/c1-3(6)2-5-4/h2H2,1H3/q-1 |
| InChIKey | PNWVJZQLASADGQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 51.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.09 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyliminoazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyliminoazanide?
The IUPAC name of 2-oxopropyliminoazanide (CID 59937174) is 2-oxopropyliminoazanide.
What is the SMILES notation for 2-oxopropyliminoazanide?
The canonical SMILES for 2-oxopropyliminoazanide is CC(=O)CN=[N-].
What is the InChIKey of 2-oxopropyliminoazanide?
The InChIKey is PNWVJZQLASADGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N2O/c1-3(6)2-5-4/h2H2,1H3/q-1.
What are the key properties of 2-oxopropyliminoazanide?
2-oxopropyliminoazanide has a molecular weight of 85.09 g/mol, XLogP of 0.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyliminoazanide is sourced from PubChem (CID 59937174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).