C11H16F3NO3 — CID 59940783
2,3-dimethylbut-2-enyl 2-[methyl-(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 59940783) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is 2,3-dimethylbut-2-enyl 2-[methyl-(2,2,2-trifluoroacetyl)amino]acetate.
| Compound Name | 2,3-dimethylbut-2-enyl 2-[methyl-(2,2,2-trifluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 59940783 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2,3-dimethylbut-2-enyl 2-[methyl-(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | CC(C)=C(C)COC(=O)CN(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO3/c1-7(2)8(3)6-18-9(16)5-15(4)10(17)11(12,13)14/h5-6H2,1-4H3 |
| InChIKey | UOHQGYQCBRCKFF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|