C15H27N2+ — CID 59941725
1,3,3-trimethyl-2-[(1,4,4-trimethyl-2,3-dihydropyrrol-1-ium-5-yl)methylidene]pyrrolidine (PubChem CID 59941725) has the molecular formula C15H27N2+ and a molecular weight of 235.39 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1,4,4-trimethyl-2,3-dihydropyrrol-1-ium-5-yl)methylidene]pyrrolidine.
| Compound Name | 1,3,3-trimethyl-2-[(1,4,4-trimethyl-2,3-dihydropyrrol-1-ium-5-yl)methylidene]pyrrolidine |
|---|---|
| PubChem CID | 59941725 |
| Molecular Formula | C15H27N2+ |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.22 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1,4,4-trimethyl-2,3-dihydropyrrol-1-ium-5-yl)methylidene]pyrrolidine |
| SMILES | CN1CCC(C)(C)C1=CC1=[N+](C)CCC1(C)C |
| InChI | InChI=1S/C15H27N2/c1-14(2)7-9-16(5)12(14)11-13-15(3,4)8-10-17(13)6/h11H,7-10H2,1-6H3/q+1 |
| InChIKey | WXJWDIBRZQYHKH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|