C18H20N4O6 — CID 59947236
2-(1,3-benzodioxol-5-yl)-N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]acetamide (PubChem CID 59947236) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]acetamide |
|---|---|
| PubChem CID | 59947236 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(10S)-10-formyl-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepin-2-yl]acetamide |
| SMILES | O=C[C@@H]1CCCN2C(=O)CCN(NC(=O)Cc3ccc4c(c3)OCO4)C(=O)N12 |
| InChI | InChI=1S/C18H20N4O6/c23-10-13-2-1-6-21-17(25)5-7-20(18(26)22(13)21)19-16(24)9-12-3-4-14-15(8-12)28-11-27-14/h3-4,8,10,13H,1-2,5-7,9,11H2,(H,19,24)/t13-/m0/s1 |
| InChIKey | OPZOQHBVWZNHKU-ZDUSSCGKSA-N |
| XLogP | 0.22 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|