C43H28N2O9S — CID 59950484
2-methyl-5-[2-[3-[4-[4-(3-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione (PubChem CID 59950484) has the molecular formula C43H28N2O9S and a molecular weight of 748.77 g/mol. Its IUPAC name is 2-methyl-5-[2-[3-[4-[4-(3-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[2-[3-[4-[4-(3-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59950484 |
| Molecular Formula | C43H28N2O9S |
| Molecular Weight | 748.77 g/mol |
| Exact Mass | 748.15 |
| IUPAC Name | 2-methyl-5-[2-[3-[4-[4-(3-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
| SMILES | Cc1cccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4cccc(N5C(=O)c6ccc(C(=O)c7ccc8c(c7)C(=O)N(C)C8=O)cc6C5=O)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C43H28N2O9S/c1-25-5-3-7-31(21-25)53-29-11-15-33(16-12-29)55(51,52)34-17-13-30(14-18-34)54-32-8-4-6-28(24-32)45-42(49)36-20-10-27(23-38(36)43(45)50)39(46)26-9-19-35-37(22-26)41(48)44(2)40(35)47/h3-24H,1-2H3 |
| InChIKey | ZGVDBONVTNWDDR-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 144.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.77 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|