C27H38N2O4S — CID 59953522
(2S)-2-[[4-[(heptan-4-ylamino)oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 59953522) has the molecular formula C27H38N2O4S and a molecular weight of 486.68 g/mol. Its IUPAC name is (2S)-2-[[4-[(heptan-4-ylamino)oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[(heptan-4-ylamino)oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 59953522 |
| Molecular Formula | C27H38N2O4S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | (2S)-2-[[4-[(heptan-4-ylamino)oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCCC(CCC)NOCc1ccc(C(=O)N[C@@H](CCSC)C(=O)O)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C27H38N2O4S/c1-5-9-21(10-6-2)29-33-18-20-13-14-23(24(17-20)22-12-8-7-11-19(22)3)26(30)28-25(27(31)32)15-16-34-4/h7-8,11-14,17,21,25,29H,5-6,9-10,15-16,18H2,1-4H3,(H,28,30)(H,31,32)/t25-/m0/s1 |
| InChIKey | XKINSCAFIAMBJE-VWLOTQADSA-N |
| XLogP | 5.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|