C49H43N5O4 — CID 59954751
O-[5-[(Z)-2-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]ethenyl]-2-[(Z)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-4-nitrophenoxy]hydroxylamine (PubChem CID 59954751) has the molecular formula C49H43N5O4 and a molecular weight of 765.91 g/mol. Its IUPAC name is O-[5-[(Z)-2-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]ethenyl]-2-[(Z)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-4-nitrophenoxy]hydroxylamine.
| Compound Name | O-[5-[(Z)-2-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]ethenyl]-2-[(Z)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-4-nitrophenoxy]hydroxylamine |
|---|---|
| PubChem CID | 59954751 |
| Molecular Formula | C49H43N5O4 |
| Molecular Weight | 765.91 g/mol |
| Exact Mass | 765.33 |
| IUPAC Name | O-[5-[(Z)-2-[4-(N-[4-(dimethylamino)phenyl]anilino)phenyl]ethenyl]-2-[(Z)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-4-nitrophenoxy]hydroxylamine |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(/C=C\c3cc([N+](=O)[O-])c(/C=C\c4ccc(N(c5ccccc5)c5ccc(N(C)C)cc5)cc4)cc3OON)cc2)cc1 |
| InChI | InChI=1S/C49H43N5O4/c1-36-14-24-44(25-15-36)52(42-10-6-4-7-11-42)45-28-20-38(21-29-45)17-23-40-34-48(54(55)56)39(35-49(40)57-58-50)22-16-37-18-26-46(27-19-37)53(43-12-8-5-9-13-43)47-32-30-41(31-33-47)51(2)3/h4-35H,50H2,1-3H3/b22-16-,23-17- |
| InChIKey | MLILDKAUEBZHEO-IDUDEYGOSA-N |
| XLogP | 12.43 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.91 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|